 |
|
 |
Description |
 |
|
|
|
|
|
|
|
|
|
enzyme catalysts
aliphatic or aromatic polyglycidyl ether (CAS#122-60-1), acid/alcohol/amine/phenol EO/PO random copolymer or block copolymer, anhydrous magnesium chloride, antioxidants, 4,4`-biphenyldiol(CAS#92-88-6), Bisphenol-A(CAS#80-05-7), Bisphenol-F(CAS#620-92-8), ethoxylated bisphenol-A(i.e., Bisphenol-A ethoxylates, BPA-EO)(CAS#32492-61-8), propoxylated bisphenol-A(i.e., Bisphenol-A propoxylates, BPA-PO)(CAS#37353-75-6), ethoxylated/propoxylated bisphenol-A(i.e., Bisphenol-A ethoxylates/propoxylates, BPA-EO/PO)(CAS#62611-29-4), cinnamic acid, cinnamic alcohol, cinnamic acetate, cyclohexylphosphonic dichloride, ortho-diallyl ether Bisphenol-A, para-diallyl ether Bisphenol-A, 2,4-dihydroxybenzaldehyde (CAS#95-01-2), 2,6-dihydroxybenzaldehyde, 4,4`-dihydroxydiphenylmethane, diphenyl phosphine, enzyme catalysts, flame retardants (phosphorous and its derivatives, melamine and its derivatives, and others), glycerol triglycidyl ether (i.e., glycerin triglycidyl ether)(CAS#13236-02-7), hexane(CAS#110-54-3), diisocynate prepolymers (CAS#9048-57-1), 2-methyl-1,3-propanediol, n-pentane, iso-pentane, 4,4`-methylenebisphenol, PTFE films, resorcinol, resorcylic acid, SF6, silanes, specialty fluorine chemicals, special polyisocyanates and special fine chemicals
 Add to Basket
 Web address
|
|
|
Other goods of this manufacturer : |
|
|
|
|
EVOH resins
|
|
aliphatic or aromatic polyglycidyl ether (CAS#122-60-1), acid/alcohol/amine/phenol EO/PO random copolymer or block copolymer, anhydrous magnesium chloride, antioxidants, 4,4`-biphenyldiol(CAS#92-88-6)
|
| |
| |
|
|
| |
|
izo-pentane
|
|
|
aliphatic or aromatic polyglycidyl ether (CAS#122-60-1), acid/alcohol/amine/phenol EO/PO random copolymer or block copolymer, anhydrous magnesium chloride, antioxidants, 4,4`-biphenyldiol(CAS#92-88-6)
|
| |
|
n-pentane
|
|
|
aliphatic or aromatic polyglycidyl ether (CAS#122-60-1), acid/alcohol/amine/phenol EO/PO random copolymer or block copolymer, anhydrous magnesium chloride, antioxidants, 4,4`-biphenyldiol(CAS#92-88-6)
|
|
|
|
n-propanol (i.e., n-propyl alcohol) (CAS#71-23-8)
|
|
|
aliphatic or aromatic polyglycidyl ether (CAS#122-60-1), acid/alcohol/amine/phenol EO/PO random copolymer or block copolymer, anhydrous magnesium chloride, antioxidants, 4,4`-biphenyldiol (CAS#92-88-6
|
| |
|
ortho-diallyl ether Bisphenol-A
|
|
|
aliphatic or aromatic polyglycidyl ether (CAS#122-60-1), acid/alcohol/amine/phenol EO/PO random copolymer or block copolymer, anhydrous magnesium chloride, antioxidants, 4,4`-biphenyldiol(CAS#92-88-6)
|
| |
|
para-diallyl ether Bisphenol-A
|
|
|
aliphatic or aromatic polyglycidyl ether (CAS#122-60-1), acid/alcohol/amine/phenol EO/PO random copolymer or block copolymer, anhydrous magnesium chloride, antioxidants, 4,4`-biphenyldiol(CAS#92-88-6)
|
|
|
|
| Likewise in category "Other Chemical Products": |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
help
Add to favorite
Favorite products
