|
|
|
|
2.3 butanedioneCAS:431-03-8Purity: 99% Appearence: Light yellow liquidPackage: 25KG/drumEXW wuhan Price:10.6$/kg
|
| |
|
|
|
3 - indole acetic acidEnglish name: indole-3-acetic acid; β-indoleacetic acid; heteroauxinAppearance: colorless crystal or crystalline powder phyllodesCAS RN 87-51-4EINECS No. 201-748-2Molecular
|
| |
|
|
|
3,3'-Diaminodiphenyl sulfoneAnother Name: 3-Aminophenyl sulfone;Bis(3-aminophenyl) sulfone;3,3‘-Sulfonyldianiline CAS: 599-61-1EINECS: 209-967-5Molecular Weight: 248.30Molecular
|
|
|
|
|
|
Purity:99% Best price high quality3,4-DihydroxybenzaldehydeOther names:Protocatechualdehyd;AURORA 17180; AKOS BBS-00003254; 4-FORMYL-1,2-DIHYDROXYBENZENE CAS number: 139-85-5EINECS num
|
| |
|
|
|
Best price high quality3,4-DihydroxybenzaldehydeOther names:Protocatechualdehyd;AURORA 17180; AKOS BBS-00003254; 4-FORMYL-1,2-DIHYDROXYBENZENE CAS number: 139-85-5EINECS number: 205-377-7Fo
|
| |
|
|
|
product Name 3,4-Dimethoxybenzoic acid Synonyms Veratric acid; 3,4-dimethoxybenzoate Molecular Formula C9H9O4 Molecular Weight 181.1659 InChI InChI=1/C9H10O4/c1-12-7-4-3-6(9(10)11)
|
|
|
|
|
|
3,5-Dimethyl-4-methoxy-2-pyridinemethanol Application: Omeprazole intermediate Appearance: white or off-white powder Type: Pharmaceutical Intermediates,Syntheses Mat
|
| |
|
|
|
3-AMINO-2-CHLORO-4-METHYLPYRIDINE Appearance: white powder Grade Standard: Industrial Grade,Fine Chemical CAS NO:133627-45-9Packaging Detail:25kg/ barrelpurity:99%
|
| |
|
|
|
With the appearance of the characters: colorless viscous liquid, hygroscopicity.The melting point (c): -40Relative density (water =1): 1.3218Boiling point (c): 139 (2.39kPa)Molecular formula: C3H7CIO2
|
|