|
|
|
|
English Name: N-2,3-Trimethyl-2-isopropylbutanamide; [2]WS-23; N, 2,3-trimethyl-2- (propan-2-yl) butanamideCAS:51115-67-4EINECS:256-974-4Molecular formula: C10H21NOMolecular weight: 171.2798Use:WS-23
|
| |
|
|
|
N-(3-Chloropropyl)morpholine Packaging Detail: 25kg/drum, 50kg/drum Delivery Detail: within 3 working days upon the receipt of the payment CAS No.: 7357-67-7 Other Names: &n
|
| |
|
|
|
N-(Dibenz[b,f]oxepin-10-ylmethyl)-N-Methyl-N-(2-propynyl)aminemaleateCAS NO:2001-89-9Packaging Detail:25kg/ barrelpurity:78-83%
|
|
|
|
|
|
English name: N-Acetyl-L-CysteineCAS No: 616-91-1Molecular formula: C5H9NO3SMolecular Weight: 163.20Properties: white crystalline powderodor similar to garlic, Pickle; have cited wet. Solubl
|
| |
|
|
|
Product name:N-Acetyl-L-LeucineCAS No.: 1188-21-2SpcificationItem SpecificationAppearance White crystals or crystalline powderSpecific Rotation[ ± ] D20 -22.0° to -26.0°State of solutio
|
| |
|
|
|
Product name: N-acetyl-L-tyrosineCAS No.: 537-55-3Molecular formula: C11H13NO4Molecular Weight: 223.23Appearance: white crystal or crystalline powderSpecific Rotation: +46.5 ~ +49.0 °Transmittance
|
|
|
|
|
|
N-Benzyl-4-piperidone Appearance: Powder Type: Pharmaceutical Intermediates CAS NO:3612-20-2Packaging Detail:25kg/ barrelpurity:98%
|
| |
|
|
|
ProName: N-Ethyl-D-glucamineCasNo: 14216-22-9MF: C8H19NO5MW: 209.24Purity: 99%Melting point: 136-140℃Solubility:H2O: 0.1 g/mL, clear, colorlessAppearance: Solid powderPackag: 25kg/barrelStorage: Sto
|
| |
|
|
|
Product name: N-Methyl-D-glucamine CAS NO: 6284-40-8 EINECS: 245-582-9 Molecular formula:C7H17NO5 Molecular weight:195.21 Appearance:white powder Melting point: 128 ~13
|
|